C12H11Cl2N5S — CID 65476228
5,7-dichloro-N-(3-imidazol-1-ylpropyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 65476228) has the molecular formula C12H11Cl2N5S and a molecular weight of 328.23 g/mol. Its IUPAC name is 5,7-dichloro-N-(3-imidazol-1-ylpropyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5,7-dichloro-N-(3-imidazol-1-ylpropyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65476228 |
| Molecular Formula | C12H11Cl2N5S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 5,7-dichloro-N-(3-imidazol-1-ylpropyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | Clc1cc(Cl)c2nsnc2c1NCCCn1ccnc1 |
| InChI | InChI=1S/C12H11Cl2N5S/c13-8-6-9(14)11-12(18-20-17-11)10(8)16-2-1-4-19-5-3-15-7-19/h3,5-7,16H,1-2,4H2 |
| InChIKey | GTXKVYKOMIAYNY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|