C10H12ClN5O — CID 78913344
5-chloro-4-(3-imidazol-1-ylpropylamino)-1H-pyridazin-6-one (PubChem CID 78913344) has the molecular formula C10H12ClN5O and a molecular weight of 253.69 g/mol. Its IUPAC name is 5-chloro-4-(3-imidazol-1-ylpropylamino)-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-(3-imidazol-1-ylpropylamino)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 78913344 |
| Molecular Formula | C10H12ClN5O |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-chloro-4-(3-imidazol-1-ylpropylamino)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NCCCn2ccnc2)c1Cl |
| InChI | InChI=1S/C10H12ClN5O/c11-9-8(6-14-15-10(9)17)13-2-1-4-16-5-3-12-7-16/h3,5-7H,1-2,4H2,(H2,13,15,17) |
| InChIKey | XOTWCGYMUUQUEM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|