C14H20ClN5O — CID 114432842
4-chloro-5-(3-imidazol-1-ylpropylamino)-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 114432842) has the molecular formula C14H20ClN5O and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-chloro-5-(3-imidazol-1-ylpropylamino)-2-(2-methylpropyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-(3-imidazol-1-ylpropylamino)-2-(2-methylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114432842 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-chloro-5-(3-imidazol-1-ylpropylamino)-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | CC(C)Cn1ncc(NCCCn2ccnc2)c(Cl)c1=O |
| InChI | InChI=1S/C14H20ClN5O/c1-11(2)9-20-14(21)13(15)12(8-18-20)17-4-3-6-19-7-5-16-10-19/h5,7-8,10-11,17H,3-4,6,9H2,1-2H3 |
| InChIKey | XGMZALCVGONBNS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|