C9H10ClN5O — CID 136974702
5-chloro-4-(2-imidazol-1-ylethylamino)-1H-pyrimidin-6-one (PubChem CID 136974702) has the molecular formula C9H10ClN5O and a molecular weight of 239.67 g/mol. Its IUPAC name is 5-chloro-4-(2-imidazol-1-ylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2-imidazol-1-ylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974702 |
| Molecular Formula | C9H10ClN5O |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-chloro-4-(2-imidazol-1-ylethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCn2ccnc2)c1Cl |
| InChI | InChI=1S/C9H10ClN5O/c10-7-8(13-5-14-9(7)16)12-2-4-15-3-1-11-6-15/h1,3,5-6H,2,4H2,(H2,12,13,14,16) |
| InChIKey | ZMLLGQZLYPFLEI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |