C8H10ClN3O — CID 137259056
4-[[(E)-but-2-enyl]amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 137259056) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 4-[[(E)-but-2-enyl]amino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[[(E)-but-2-enyl]amino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137259056 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 4-[[(E)-but-2-enyl]amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | C/C=C/CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H10ClN3O/c1-2-3-4-10-7-6(9)8(13)12-5-11-7/h2-3,5H,4H2,1H3,(H2,10,11,12,13)/b3-2+ |
| InChIKey | AUGDFQZUZYZBPQ-NSCUHMNNSA-N |
| XLogP | 1.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|