C10H15Cl2N3O — CID 136755785
5-chloro-4-(6-chlorohexylamino)-1H-pyrimidin-6-one (PubChem CID 136755785) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is 5-chloro-4-(6-chlorohexylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(6-chlorohexylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136755785 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-chloro-4-(6-chlorohexylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCCCCCCl)c1Cl |
| InChI | InChI=1S/C10H15Cl2N3O/c11-5-3-1-2-4-6-13-9-8(12)10(16)15-7-14-9/h7H,1-6H2,(H2,13,14,15,16) |
| InChIKey | IEDNQBSEKMQOKD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|