C7H9Cl2N3O — CID 136971845
5-chloro-4-(3-chloropropylamino)-1H-pyrimidin-6-one (PubChem CID 136971845) has the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. Its IUPAC name is 5-chloro-4-(3-chloropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(3-chloropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971845 |
| Molecular Formula | C7H9Cl2N3O |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 5-chloro-4-(3-chloropropylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCCCl)c1Cl |
| InChI | InChI=1S/C7H9Cl2N3O/c8-2-1-3-10-6-5(9)7(13)12-4-11-6/h4H,1-3H2,(H2,10,11,12,13) |
| InChIKey | CKNGSADHIAHXLU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|