C8H10BrN5S — CID 64623662
5-bromo-N-(3-imidazol-1-ylpropyl)-1,3,4-thiadiazol-2-amine (PubChem CID 64623662) has the molecular formula C8H10BrN5S and a molecular weight of 288.17 g/mol. Its IUPAC name is 5-bromo-N-(3-imidazol-1-ylpropyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-(3-imidazol-1-ylpropyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 64623662 |
| Molecular Formula | C8H10BrN5S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 5-bromo-N-(3-imidazol-1-ylpropyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Brc1nnc(NCCCn2ccnc2)s1 |
| InChI | InChI=1S/C8H10BrN5S/c9-7-12-13-8(15-7)11-2-1-4-14-5-3-10-6-14/h3,5-6H,1-2,4H2,(H,11,13) |
| InChIKey | OULSAGZUCZHGHZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|