C10H13N3S — CID 91018147
N-(3-imidazol-1-ylpropyl)thiophen-2-amine (PubChem CID 91018147) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)thiophen-2-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)thiophen-2-amine |
|---|---|
| PubChem CID | 91018147 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)thiophen-2-amine |
| SMILES | c1csc(NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C10H13N3S/c1-3-10(14-8-1)12-4-2-6-13-7-5-11-9-13/h1,3,5,7-9,12H,2,4,6H2 |
| InChIKey | IENVUJRWECMOLS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|