C16H23N3S — CID 43773858
N-[cyclopentyl(thiophen-2-yl)methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 43773858) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 43773858 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | c1csc(C(NCCCn2ccnc2)C2CCCC2)c1 |
| InChI | InChI=1S/C16H23N3S/c1-2-6-14(5-1)16(15-7-3-12-20-15)18-8-4-10-19-11-9-17-13-19/h3,7,9,11-14,16,18H,1-2,4-6,8,10H2 |
| InChIKey | SBMKNVQPEYIPPQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|