C11H17NS — CID 43495964
N-[cyclopropyl(thiophen-2-yl)methyl]propan-1-amine (PubChem CID 43495964) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is N-[cyclopropyl(thiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[cyclopropyl(thiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43495964 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[cyclopropyl(thiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccs1)C1CC1 |
| InChI | InChI=1S/C11H17NS/c1-2-7-12-11(9-5-6-9)10-4-3-8-13-10/h3-4,8-9,11-12H,2,5-7H2,1H3 |
| InChIKey | YMOTXRHVPJQYHL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |