C12H16F3NS — CID 113326887
N-[cyclopropyl(thiophen-2-yl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 113326887) has the molecular formula C12H16F3NS and a molecular weight of 263.33 g/mol. Its IUPAC name is N-[cyclopropyl(thiophen-2-yl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[cyclopropyl(thiophen-2-yl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 113326887 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-[cyclopropyl(thiophen-2-yl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | FC(F)(F)CCCNC(c1cccs1)C1CC1 |
| InChI | InChI=1S/C12H16F3NS/c13-12(14,15)6-2-7-16-11(9-4-5-9)10-3-1-8-17-10/h1,3,8-9,11,16H,2,4-7H2 |
| InChIKey | JSIZOHOIRSJAOE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|