C16H26N2O2S — CID 103910636
tert-butyl N-[3-[[cyclopropyl(thiophen-2-yl)methyl]amino]propyl]carbamate (PubChem CID 103910636) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is tert-butyl N-[3-[[cyclopropyl(thiophen-2-yl)methyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[cyclopropyl(thiophen-2-yl)methyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103910636 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl N-[3-[[cyclopropyl(thiophen-2-yl)methyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(c1cccs1)C1CC1 |
| InChI | InChI=1S/C16H26N2O2S/c1-16(2,3)20-15(19)18-10-5-9-17-14(12-7-8-12)13-6-4-11-21-13/h4,6,11-12,14,17H,5,7-10H2,1-3H3,(H,18,19) |
| InChIKey | LEZUHCWRIDPYGH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|