C13H21NO2S2 — CID 113422005
N-[(1,1-dioxothian-2-yl)-thiophen-2-ylmethyl]propan-1-amine (PubChem CID 113422005) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[(1,1-dioxothian-2-yl)-thiophen-2-ylmethyl]propan-1-amine.
| Compound Name | N-[(1,1-dioxothian-2-yl)-thiophen-2-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 113422005 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[(1,1-dioxothian-2-yl)-thiophen-2-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1cccs1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H21NO2S2/c1-2-8-14-13(11-6-5-9-17-11)12-7-3-4-10-18(12,15)16/h5-6,9,12-14H,2-4,7-8,10H2,1H3 |
| InChIKey | AKVFBZIWUVRCMF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |