C15H25NO2S2 — CID 115857152
1-(1,1-dioxothian-2-yl)-N-propyl-3-thiophen-3-ylpropan-1-amine (PubChem CID 115857152) has the molecular formula C15H25NO2S2 and a molecular weight of 315.50 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-N-propyl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(1,1-dioxothian-2-yl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 115857152 |
| Molecular Formula | C15H25NO2S2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-N-propyl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCCNC(CCc1ccsc1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H25NO2S2/c1-2-9-16-14(7-6-13-8-10-19-12-13)15-5-3-4-11-20(15,17)18/h8,10,12,14-16H,2-7,9,11H2,1H3 |
| InChIKey | MJSDFISWLRCCJJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |