C13H27NO4S2 — CID 115820861
1-(1,1-dioxothian-2-yl)-4-methylsulfonyl-N-propylbutan-1-amine (PubChem CID 115820861) has the molecular formula C13H27NO4S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-4-methylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 1-(1,1-dioxothian-2-yl)-4-methylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 115820861 |
| Molecular Formula | C13H27NO4S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-4-methylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H27NO4S2/c1-3-9-14-12(7-6-10-19(2,15)16)13-8-4-5-11-20(13,17)18/h12-14H,3-11H2,1-2H3 |
| InChIKey | UZRBYSVWXYHQSE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |