C15H31NO2S — CID 115832238
1-(1,1-dioxothian-2-yl)-N-ethyloctan-1-amine (PubChem CID 115832238) has the molecular formula C15H31NO2S and a molecular weight of 289.48 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-N-ethyloctan-1-amine.
| Compound Name | 1-(1,1-dioxothian-2-yl)-N-ethyloctan-1-amine |
|---|---|
| PubChem CID | 115832238 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-N-ethyloctan-1-amine |
| SMILES | CCCCCCCC(NCC)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H31NO2S/c1-3-5-6-7-8-11-14(16-4-2)15-12-9-10-13-19(15,17)18/h14-16H,3-13H2,1-2H3 |
| InChIKey | JWKJPCJKBLASEW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|