C16H24INO2S — CID 115864313
N-[1-(1,1-dioxothian-2-yl)-2-(4-iodophenyl)ethyl]propan-1-amine (PubChem CID 115864313) has the molecular formula C16H24INO2S and a molecular weight of 421.34 g/mol. Its IUPAC name is N-[1-(1,1-dioxothian-2-yl)-2-(4-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(1,1-dioxothian-2-yl)-2-(4-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115864313 |
| Molecular Formula | C16H24INO2S |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-[1-(1,1-dioxothian-2-yl)-2-(4-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(I)cc1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C16H24INO2S/c1-2-10-18-15(12-13-6-8-14(17)9-7-13)16-5-3-4-11-21(16,19)20/h6-9,15-16,18H,2-5,10-12H2,1H3 |
| InChIKey | ATHWJCDHFSFTCF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|