C19H30IN — CID 65479388
N-[1-(4-ethylcyclohexyl)-2-(4-iodophenyl)ethyl]propan-1-amine (PubChem CID 65479388) has the molecular formula C19H30IN and a molecular weight of 399.36 g/mol. Its IUPAC name is N-[1-(4-ethylcyclohexyl)-2-(4-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-ethylcyclohexyl)-2-(4-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 65479388 |
| Molecular Formula | C19H30IN |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[1-(4-ethylcyclohexyl)-2-(4-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(I)cc1)C1CCC(CC)CC1 |
| InChI | InChI=1S/C19H30IN/c1-3-13-21-19(14-16-7-11-18(20)12-8-16)17-9-5-15(4-2)6-10-17/h7-8,11-12,15,17,19,21H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | SWPABNVMENZBFF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|