C14H20IN — CID 65478174
1-cyclobutyl-N-ethyl-2-(4-iodophenyl)ethanamine (PubChem CID 65478174) has the molecular formula C14H20IN and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-cyclobutyl-N-ethyl-2-(4-iodophenyl)ethanamine.
| Compound Name | 1-cyclobutyl-N-ethyl-2-(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 65478174 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-cyclobutyl-N-ethyl-2-(4-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1ccc(I)cc1)C1CCC1 |
| InChI | InChI=1S/C14H20IN/c1-2-16-14(12-4-3-5-12)10-11-6-8-13(15)9-7-11/h6-9,12,14,16H,2-5,10H2,1H3 |
| InChIKey | CQYMEQFOZBKLIF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|