C20H33N — CID 63413965
2-(4-tert-butylphenyl)-1-cyclohexyl-N-ethylethanamine (PubChem CID 63413965) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-cyclohexyl-N-ethylethanamine.
| Compound Name | 2-(4-tert-butylphenyl)-1-cyclohexyl-N-ethylethanamine |
|---|---|
| PubChem CID | 63413965 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-cyclohexyl-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(C(C)(C)C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H33N/c1-5-21-19(17-9-7-6-8-10-17)15-16-11-13-18(14-12-16)20(2,3)4/h11-14,17,19,21H,5-10,15H2,1-4H3 |
| InChIKey | JAPAUKSUGHDZIQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |