C18H29N — CID 112569630
3-(4-tert-butylphenyl)-2-cyclopentylpropan-1-amine (PubChem CID 112569630) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-cyclopentylpropan-1-amine.
| Compound Name | 3-(4-tert-butylphenyl)-2-cyclopentylpropan-1-amine |
|---|---|
| PubChem CID | 112569630 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-cyclopentylpropan-1-amine |
| SMILES | CC(C)(C)c1ccc(CC(CN)C2CCCC2)cc1 |
| InChI | InChI=1S/C18H29N/c1-18(2,3)17-10-8-14(9-11-17)12-16(13-19)15-6-4-5-7-15/h8-11,15-16H,4-7,12-13,19H2,1-3H3 |
| InChIKey | BTKBZCFYAVPYMH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |