C15H20F3N — CID 112569664
2-cyclopentyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 112569664) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-cyclopentyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 2-cyclopentyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 112569664 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-cyclopentyl-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | NCC(Cc1cccc(C(F)(F)F)c1)C1CCCC1 |
| InChI | InChI=1S/C15H20F3N/c16-15(17,18)14-7-3-4-11(9-14)8-13(10-19)12-5-1-2-6-12/h3-4,7,9,12-13H,1-2,5-6,8,10,19H2 |
| InChIKey | WBHOWIZBZJZQCZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |