C15H20F3N — CID 65415364
1-(3-methylcyclopentyl)-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 65415364) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is 1-(3-methylcyclopentyl)-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 1-(3-methylcyclopentyl)-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 65415364 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-(3-methylcyclopentyl)-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC1CCC(C(N)Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H20F3N/c1-10-5-6-12(7-10)14(19)9-11-3-2-4-13(8-11)15(16,17)18/h2-4,8,10,12,14H,5-7,9,19H2,1H3 |
| InChIKey | QMRSYSQLPBKCQO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |