C14H20IN — CID 65476305
2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanamine (PubChem CID 65476305) has the molecular formula C14H20IN and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanamine.
| Compound Name | 2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanamine |
|---|---|
| PubChem CID | 65476305 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanamine |
| SMILES | CC1CCC(C(N)Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H20IN/c1-10-2-5-12(8-10)14(16)9-11-3-6-13(15)7-4-11/h3-4,6-7,10,12,14H,2,5,8-9,16H2,1H3 |
| InChIKey | SDLPMGZVCLCQLT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|