C12H17N — CID 54594185
1-cyclopropyl-2-(3-methylphenyl)ethanamine (PubChem CID 54594185) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-cyclopropyl-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 54594185 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-cyclopropyl-2-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(CC(N)C2CC2)c1 |
| InChI | InChI=1S/C12H17N/c1-9-3-2-4-10(7-9)8-12(13)11-5-6-11/h2-4,7,11-12H,5-6,8,13H2,1H3 |
| InChIKey | UUOFPYZAPDEVGZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |