C17H25NO2 — CID 79914739
1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(3-methylphenyl)ethanamine (PubChem CID 79914739) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 79914739 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(CC(N)C2CCOC3(CCOC3)C2)c1 |
| InChI | InChI=1S/C17H25NO2/c1-13-3-2-4-14(9-13)10-16(18)15-5-7-20-17(11-15)6-8-19-12-17/h2-4,9,15-16H,5-8,10-12,18H2,1H3 |
| InChIKey | NTISMKOGRZHCCF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |