C16H22ClNO2 — CID 79914830
2-(2-chlorophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanamine (PubChem CID 79914830) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanamine |
|---|---|
| PubChem CID | 79914830 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanamine |
| SMILES | NC(Cc1ccccc1Cl)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C16H22ClNO2/c17-14-4-2-1-3-12(14)9-15(18)13-5-7-20-16(10-13)6-8-19-11-16/h1-4,13,15H,5-11,18H2 |
| InChIKey | OSJVDRKJGZNPCR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |