C17H23Cl2NO — CID 79908679
2-(2,6-dichlorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine (PubChem CID 79908679) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine |
|---|---|
| PubChem CID | 79908679 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(6-oxaspiro[4.5]decan-9-yl)ethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H23Cl2NO/c18-14-4-3-5-15(19)13(14)10-16(20)12-6-9-21-17(11-12)7-1-2-8-17/h3-5,12,16H,1-2,6-11,20H2 |
| InChIKey | IJGILCOHSQTRPZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |