C16H23ClN2OS — CID 105209506
[2-(2-chlorophenyl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine (PubChem CID 105209506) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine.
| Compound Name | [2-(2-chlorophenyl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105209506 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [2-(2-chlorophenyl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccccc1Cl)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C16H23ClN2OS/c17-14-4-2-1-3-12(14)9-15(19-18)13-5-7-20-16(10-13)6-8-21-11-16/h1-4,13,15,19H,5-11,18H2 |
| InChIKey | VROJRVLNFHEKCX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|