C14H23N3OS2 — CID 105214641
[2-(2-methyl-1,3-thiazol-4-yl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine (PubChem CID 105214641) has the molecular formula C14H23N3OS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is [2-(2-methyl-1,3-thiazol-4-yl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105214641 |
| Molecular Formula | C14H23N3OS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [2-(2-methyl-1,3-thiazol-4-yl)-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)C2CCOC3(CCSC3)C2)cs1 |
| InChI | InChI=1S/C14H23N3OS2/c1-10-16-12(8-20-10)6-13(17-15)11-2-4-18-14(7-11)3-5-19-9-14/h8,11,13,17H,2-7,9,15H2,1H3 |
| InChIKey | UBWCHUHGHUVRBI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|