C14H25N3S — CID 105231799
[1-(4,4-dimethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105231799) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is [1-(4,4-dimethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(4,4-dimethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105231799 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [1-(4,4-dimethylcyclohexyl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)C2CCC(C)(C)CC2)cs1 |
| InChI | InChI=1S/C14H25N3S/c1-10-16-12(9-18-10)8-13(17-15)11-4-6-14(2,3)7-5-11/h9,11,13,17H,4-8,15H2,1-3H3 |
| InChIKey | MBSRDCKVDFWJBB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|