C13H23F3N2O2S — CID 103151443
[1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151443) has the molecular formula C13H23F3N2O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is [1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151443 |
| Molecular Formula | C13H23F3N2O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C13H23F3N2O2S/c14-13(15,16)8-19-4-2-11(18-17)10-1-5-20-12(7-10)3-6-21-9-12/h10-11,18H,1-9,17H2 |
| InChIKey | RGNHTQSJUMQAAS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|