C13H26N2O3 — CID 105206283
[1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methoxypropyl]hydrazine (PubChem CID 105206283) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is [1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methoxypropyl]hydrazine.
| Compound Name | [1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methoxypropyl]hydrazine |
|---|---|
| PubChem CID | 105206283 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | [1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-methoxypropyl]hydrazine |
| SMILES | COCCC(NN)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-16-6-3-12(15-14)11-2-7-18-13(10-11)4-8-17-9-5-13/h11-12,15H,2-10,14H2,1H3 |
| InChIKey | JVLQJHIVXLKXNR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|