C15H27F2NO3 — CID 103149235
3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-methylpropan-1-amine (PubChem CID 103149235) has the molecular formula C15H27F2NO3 and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103149235 |
| Molecular Formula | C15H27F2NO3 |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-methylpropan-1-amine |
| SMILES | CNC(CCOCC(F)F)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H27F2NO3/c1-18-13(3-6-20-11-14(16)17)12-2-7-21-15(10-12)4-8-19-9-5-15/h12-14,18H,2-11H2,1H3 |
| InChIKey | KAQGVRJAJMFMFH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|