C14H26F2N2O2S — CID 103151883
[3-(2,2-difluoroethoxy)-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propyl]hydrazine (PubChem CID 103151883) has the molecular formula C14H26F2N2O2S and a molecular weight of 324.44 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propyl]hydrazine.
| Compound Name | [3-(2,2-difluoroethoxy)-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 103151883 |
| Molecular Formula | C14H26F2N2O2S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)F)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C14H26F2N2O2S/c15-13(16)10-19-5-2-12(18-17)11-1-6-20-14(9-11)3-7-21-8-4-14/h11-13,18H,1-10,17H2 |
| InChIKey | MEHWBWKSKWTJDO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|