C14H29N3OS — CID 105259141
3-hydrazinyl-N,N-dimethyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propan-1-amine (PubChem CID 105259141) has the molecular formula C14H29N3OS and a molecular weight of 287.47 g/mol. Its IUPAC name is 3-hydrazinyl-N,N-dimethyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propan-1-amine.
| Compound Name | 3-hydrazinyl-N,N-dimethyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 105259141 |
| Molecular Formula | C14H29N3OS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-hydrazinyl-N,N-dimethyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)propan-1-amine |
| SMILES | CN(C)CCC(NN)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C14H29N3OS/c1-17(2)7-3-13(16-15)12-4-8-18-14(11-12)5-9-19-10-6-14/h12-13,16H,3-11,15H2,1-2H3 |
| InChIKey | YPIBGSRCWBBARO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|