C13H26N2O2 — CID 105199138
[1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylbutyl]hydrazine (PubChem CID 105199138) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylbutyl]hydrazine.
| Compound Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 105199138 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylbutyl]hydrazine |
| SMILES | CC(C)CC(NN)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-10(2)7-12(15-14)11-3-5-17-13(8-11)4-6-16-9-13/h10-12,15H,3-9,14H2,1-2H3 |
| InChIKey | NAYVRPVXDABUAL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|