C15H28O3 — CID 114200597
1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,4-dimethylpentan-1-ol (PubChem CID 114200597) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,4-dimethylpentan-1-ol.
| Compound Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114200597 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,4-dimethylpentan-1-ol |
| SMILES | CC(C)CC(C)C(O)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H28O3/c1-11(2)8-12(3)14(16)13-4-6-18-15(9-13)5-7-17-10-15/h11-14,16H,4-10H2,1-3H3 |
| InChIKey | JFLQGCNXPZQMCU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |