C15H28O4 — CID 103459636
1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-ethylpentane-1,2-diol (PubChem CID 103459636) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is 1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-ethylpentane-1,2-diol.
| Compound Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-ethylpentane-1,2-diol |
|---|---|
| PubChem CID | 103459636 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-ethylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H28O4/c1-3-11(4-2)13(16)14(17)12-5-7-19-15(9-12)6-8-18-10-15/h11-14,16-17H,3-10H2,1-2H3 |
| InChIKey | YJLPVFINXRDYHN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |