C17H24O3 — CID 79899764
2,6-dioxaspiro[4.5]decan-9-yl-(4-ethylphenyl)methanol (PubChem CID 79899764) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl-(4-ethylphenyl)methanol.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl-(4-ethylphenyl)methanol |
|---|---|
| PubChem CID | 79899764 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl-(4-ethylphenyl)methanol |
| SMILES | CCc1ccc(C(O)C2CCOC3(CCOC3)C2)cc1 |
| InChI | InChI=1S/C17H24O3/c1-2-13-3-5-14(6-4-13)16(18)15-7-9-20-17(11-15)8-10-19-12-17/h3-6,15-16,18H,2,7-12H2,1H3 |
| InChIKey | NRZMERSCBJYVJG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |