C15H18Br2O3 — CID 115823298
(2,5-dibromophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol (PubChem CID 115823298) has the molecular formula C15H18Br2O3 and a molecular weight of 406.11 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2,5-dibromophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 115823298 |
| Molecular Formula | C15H18Br2O3 |
| Molecular Weight | 406.11 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | (2,5-dibromophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol |
| SMILES | OC(c1cc(Br)ccc1Br)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H18Br2O3/c16-11-1-2-13(17)12(7-11)14(18)10-3-5-20-15(8-10)4-6-19-9-15/h1-2,7,10,14,18H,3-6,8-9H2 |
| InChIKey | FXXCGFUSUVDAFW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |