C15H18F2O3 — CID 79913258
(2,3-difluorophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol (PubChem CID 79913258) has the molecular formula C15H18F2O3 and a molecular weight of 284.30 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2,3-difluorophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 79913258 |
| Molecular Formula | C15H18F2O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2,3-difluorophenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol |
| SMILES | OC(c1cccc(F)c1F)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H18F2O3/c16-12-3-1-2-11(13(12)17)14(18)10-4-6-20-15(8-10)5-7-19-9-15/h1-3,10,14,18H,4-9H2 |
| InChIKey | KTEIOHCDZQGYED-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |