C16H21ClO3 — CID 106859418
(2-chloro-4-methylphenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol (PubChem CID 106859418) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is (2-chloro-4-methylphenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2-chloro-4-methylphenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 106859418 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2-chloro-4-methylphenyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanol |
| SMILES | Cc1ccc(C(O)C2CCOC3(CCOC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClO3/c1-11-2-3-13(14(17)8-11)15(18)12-4-6-20-16(9-12)5-7-19-10-16/h2-3,8,12,15,18H,4-7,9-10H2,1H3 |
| InChIKey | XIPBQIVEQAFHJV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |