C17H22Cl2O2 — CID 79902054
(2,4-dichlorophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 79902054) has the molecular formula C17H22Cl2O2 and a molecular weight of 329.27 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 79902054 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2,4-dichlorophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | OC(c1ccc(Cl)cc1Cl)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C17H22Cl2O2/c18-13-4-5-14(15(19)10-13)16(20)12-6-9-21-17(11-12)7-2-1-3-8-17/h4-5,10,12,16,20H,1-3,6-9,11H2 |
| InChIKey | KKMSJVAUUFZFHJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |