C17H23IO2 — CID 115823060
(2-iodophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 115823060) has the molecular formula C17H23IO2 and a molecular weight of 386.27 g/mol. Its IUPAC name is (2-iodophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (2-iodophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 115823060 |
| Molecular Formula | C17H23IO2 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (2-iodophenyl)-(1-oxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | OC(c1ccccc1I)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C17H23IO2/c18-15-7-3-2-6-14(15)16(19)13-8-11-20-17(12-13)9-4-1-5-10-17/h2-3,6-7,13,16,19H,1,4-5,8-12H2 |
| InChIKey | UODFWKYQSGSDTB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|