C14H18Cl2O2S — CID 107969804
(2,5-dichlorothiophen-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanol (PubChem CID 107969804) has the molecular formula C14H18Cl2O2S and a molecular weight of 321.27 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 107969804 |
| Molecular Formula | C14H18Cl2O2S |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanol |
| SMILES | OC(c1cc(Cl)sc1Cl)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C14H18Cl2O2S/c15-11-7-10(13(16)19-11)12(17)9-3-6-18-14(8-9)4-1-2-5-14/h7,9,12,17H,1-6,8H2 |
| InChIKey | QVGLADWUUAQSSU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |