C13H18Cl2N2O2S — CID 107970487
[(2,5-dichlorothiophen-3-yl)-(2,6-dioxaspiro[4.5]decan-9-yl)methyl]hydrazine (PubChem CID 107970487) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is [(2,5-dichlorothiophen-3-yl)-(2,6-dioxaspiro[4.5]decan-9-yl)methyl]hydrazine.
| Compound Name | [(2,5-dichlorothiophen-3-yl)-(2,6-dioxaspiro[4.5]decan-9-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107970487 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [(2,5-dichlorothiophen-3-yl)-(2,6-dioxaspiro[4.5]decan-9-yl)methyl]hydrazine |
| SMILES | NNC(c1cc(Cl)sc1Cl)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C13H18Cl2N2O2S/c14-10-5-9(12(15)20-10)11(17-16)8-1-3-19-13(6-8)2-4-18-7-13/h5,8,11,17H,1-4,6-7,16H2 |
| InChIKey | OIEAKRICCZLFDD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|