C16H20Cl2O2 — CID 79901810
(2,4-dichlorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanol (PubChem CID 79901810) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 79901810 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (2,4-dichlorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanol |
| SMILES | OC(c1ccc(Cl)cc1Cl)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C16H20Cl2O2/c17-12-3-4-13(14(18)9-12)15(19)11-5-8-20-16(10-11)6-1-2-7-16/h3-4,9,11,15,19H,1-2,5-8,10H2 |
| InChIKey | JGSRNKHVNPXFKQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |