C15H18Cl2O2 — CID 79900057
(3,4-dichlorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol (PubChem CID 79900057) has the molecular formula C15H18Cl2O2 and a molecular weight of 301.21 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol |
|---|---|
| PubChem CID | 79900057 |
| Molecular Formula | C15H18Cl2O2 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (3,4-dichlorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol |
| SMILES | OC(c1ccc(Cl)c(Cl)c1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H18Cl2O2/c16-12-3-2-10(8-13(12)17)14(18)11-4-7-19-15(9-11)5-1-6-15/h2-3,8,11,14,18H,1,4-7,9H2 |
| InChIKey | RXACIRSVPBRVKG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |